C24H44F6Si5 — CID 101175024
[7,10-bis(trifluoromethyl)-1,4,4-tris(trimethylsilyl)-5-silaspiro[4.6]undeca-6,8,10-trien-1-yl]-trimethylsilane (PubChem CID 101175024) has the molecular formula C24H44F6Si5 and a molecular weight of 587.03 g/mol. Its IUPAC name is [7,10-bis(trifluoromethyl)-1,4,4-tris(trimethylsilyl)-5-silaspiro[4.6]undeca-6,8,10-trien-1-yl]-trimethylsilane.
| Compound Name | [7,10-bis(trifluoromethyl)-1,4,4-tris(trimethylsilyl)-5-silaspiro[4.6]undeca-6,8,10-trien-1-yl]-trimethylsilane |
|---|---|
| PubChem CID | 101175024 |
| Molecular Formula | C24H44F6Si5 |
| Molecular Weight | 587.03 g/mol |
| Exact Mass | 586.22 |
| IUPAC Name | [7,10-bis(trifluoromethyl)-1,4,4-tris(trimethylsilyl)-5-silaspiro[4.6]undeca-6,8,10-trien-1-yl]-trimethylsilane |
| SMILES | C[Si](C)(C)C1([Si](C)(C)C)CCC([Si](C)(C)C)([Si](C)(C)C)[Si]12C=C(C(F)(F)F)C=CC(C(F)(F)F)=C2 |
| InChI | InChI=1S/C24H44F6Si5/c1-31(2,3)21(32(4,5)6)15-16-22(33(7,8)9,34(10,11)12)35(21)17-19(23(25,26)27)13-14-20(18-35)24(28,29)30/h13-14,17-18H,15-16H2,1-12H3 |
| InChIKey | WSHXPRXPKQJELA-UHFFFAOYSA-N |
| XLogP | 9.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.03 |
| LogP ≤ 5 | 9.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|