C17H30Si — CID 154701868
triethyl-[(E)-2-[(4S)-4-prop-1-en-2-ylcyclohexen-1-yl]ethenyl]silane (PubChem CID 154701868) has the molecular formula C17H30Si and a molecular weight of 262.51 g/mol. Its IUPAC name is triethyl-[(E)-2-[(4S)-4-prop-1-en-2-ylcyclohexen-1-yl]ethenyl]silane.
| Compound Name | triethyl-[(E)-2-[(4S)-4-prop-1-en-2-ylcyclohexen-1-yl]ethenyl]silane |
|---|---|
| PubChem CID | 154701868 |
| Molecular Formula | C17H30Si |
| Molecular Weight | 262.51 g/mol |
| Exact Mass | 262.21 |
| IUPAC Name | triethyl-[(E)-2-[(4S)-4-prop-1-en-2-ylcyclohexen-1-yl]ethenyl]silane |
| SMILES | C=C(C)[C@@H]1CC=C(/C=C/[Si](CC)(CC)CC)CC1 |
| InChI | InChI=1S/C17H30Si/c1-6-18(7-2,8-3)14-13-16-9-11-17(12-10-16)15(4)5/h9,13-14,17H,4,6-8,10-12H2,1-3,5H3/b14-13+/t17-/m1/s1 |
| InChIKey | BBHPDSSTKFIWBI-TUQDCPSNSA-N |
| XLogP | 5.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.51 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|