C18H29Si+ — CID 134887051
tert-butyl-[(4R)-4-cyclohepta-2,4,6-trien-1-ylpent-2-en-2-yl]-dimethylsilane (PubChem CID 134887051) has the molecular formula C18H29Si+ and a molecular weight of 273.52 g/mol. Its IUPAC name is tert-butyl-[(4R)-4-cyclohepta-2,4,6-trien-1-ylpent-2-en-2-yl]-dimethylsilane.
| Compound Name | tert-butyl-[(4R)-4-cyclohepta-2,4,6-trien-1-ylpent-2-en-2-yl]-dimethylsilane |
|---|---|
| PubChem CID | 134887051 |
| Molecular Formula | C18H29Si+ |
| Molecular Weight | 273.52 g/mol |
| Exact Mass | 273.20 |
| IUPAC Name | tert-butyl-[(4R)-4-cyclohepta-2,4,6-trien-1-ylpent-2-en-2-yl]-dimethylsilane |
| SMILES | C/C(=[C+]\[C@@H](C)C1C=CC=CC=C1)[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H29Si/c1-15(17-12-10-8-9-11-13-17)14-16(2)19(6,7)18(3,4)5/h8-13,15,17H,1-7H3/q+1/t15-/m1/s1 |
| InChIKey | HJZBJJONXKFAEY-OAHLLOKOSA-N |
| XLogP | 5.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.52 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|