C12H24Si — CID 10584061
trimethyl-[(3R,4Z,6E)-2-methylocta-4,6-dien-3-yl]silane (PubChem CID 10584061) has the molecular formula C12H24Si and a molecular weight of 196.41 g/mol. Its IUPAC name is trimethyl-[(3R,4Z,6E)-2-methylocta-4,6-dien-3-yl]silane.
| Compound Name | trimethyl-[(3R,4Z,6E)-2-methylocta-4,6-dien-3-yl]silane |
|---|---|
| PubChem CID | 10584061 |
| Molecular Formula | C12H24Si |
| Molecular Weight | 196.41 g/mol |
| Exact Mass | 196.16 |
| IUPAC Name | trimethyl-[(3R,4Z,6E)-2-methylocta-4,6-dien-3-yl]silane |
| SMILES | C/C=C/C=C\[C@@H](C(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C12H24Si/c1-7-8-9-10-12(11(2)3)13(4,5)6/h7-12H,1-6H3/b8-7+,10-9-/t12-/m0/s1 |
| InChIKey | HJWFEYIQCOPNEV-GQQPRXIISA-N |
| XLogP | 4.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.41 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|