C18H32Si — CID 23266024
dimethyl-bis[(2E)-5-methylhepta-2,6-dienyl]silane (PubChem CID 23266024) has the molecular formula C18H32Si and a molecular weight of 276.54 g/mol. Its IUPAC name is dimethyl-bis[(2E)-5-methylhepta-2,6-dienyl]silane.
| Compound Name | dimethyl-bis[(2E)-5-methylhepta-2,6-dienyl]silane |
|---|---|
| PubChem CID | 23266024 |
| Molecular Formula | C18H32Si |
| Molecular Weight | 276.54 g/mol |
| Exact Mass | 276.23 |
| IUPAC Name | dimethyl-bis[(2E)-5-methylhepta-2,6-dienyl]silane |
| SMILES | C=CC(C)C/C=C/C[Si](C)(C)C/C=C/CC(C)C=C |
| InChI | InChI=1S/C18H32Si/c1-7-17(3)13-9-11-15-19(5,6)16-12-10-14-18(4)8-2/h7-12,17-18H,1-2,13-16H2,3-6H3/b11-9+,12-10+ |
| InChIKey | HPVJYZDWHFJQED-WGDLNXRISA-N |
| XLogP | 6.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.54 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|