C17H36Si — CID 10945460
[(E)-2,5-dimethylhex-3-enyl]-tri(propan-2-yl)silane (PubChem CID 10945460) has the molecular formula C17H36Si and a molecular weight of 268.56 g/mol. Its IUPAC name is [(E)-2,5-dimethylhex-3-enyl]-tri(propan-2-yl)silane.
| Compound Name | [(E)-2,5-dimethylhex-3-enyl]-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 10945460 |
| Molecular Formula | C17H36Si |
| Molecular Weight | 268.56 g/mol |
| Exact Mass | 268.26 |
| IUPAC Name | [(E)-2,5-dimethylhex-3-enyl]-tri(propan-2-yl)silane |
| SMILES | CC(C)/C=C/C(C)C[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C17H36Si/c1-13(2)10-11-17(9)12-18(14(3)4,15(5)6)16(7)8/h10-11,13-17H,12H2,1-9H3/b11-10+ |
| InChIKey | XIMQQRVSEHKDMG-ZHACJKMWSA-N |
| XLogP | 6.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.56 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|