C18H36Si — CID 101127398
triethyl-[(6E)-10-methylundeca-1,6-dien-3-yl]silane (PubChem CID 101127398) has the molecular formula C18H36Si and a molecular weight of 280.57 g/mol. Its IUPAC name is triethyl-[(6E)-10-methylundeca-1,6-dien-3-yl]silane.
| Compound Name | triethyl-[(6E)-10-methylundeca-1,6-dien-3-yl]silane |
|---|---|
| PubChem CID | 101127398 |
| Molecular Formula | C18H36Si |
| Molecular Weight | 280.57 g/mol |
| Exact Mass | 280.26 |
| IUPAC Name | triethyl-[(6E)-10-methylundeca-1,6-dien-3-yl]silane |
| SMILES | C=CC(CC/C=C/CCC(C)C)[Si](CC)(CC)CC |
| InChI | InChI=1S/C18H36Si/c1-7-18(19(8-2,9-3)10-4)16-14-12-11-13-15-17(5)6/h7,11-12,17-18H,1,8-10,13-16H2,2-6H3/b12-11+ |
| InChIKey | GCBKAYIJPKUTRE-VAWYXSNFSA-N |
| XLogP | 6.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.57 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|