C20H38Si — CID 11460962
[(6E)-8-cyclohexylocta-1,6-dien-3-yl]-triethylsilane (PubChem CID 11460962) has the molecular formula C20H38Si and a molecular weight of 306.61 g/mol. Its IUPAC name is [(6E)-8-cyclohexylocta-1,6-dien-3-yl]-triethylsilane.
| Compound Name | [(6E)-8-cyclohexylocta-1,6-dien-3-yl]-triethylsilane |
|---|---|
| PubChem CID | 11460962 |
| Molecular Formula | C20H38Si |
| Molecular Weight | 306.61 g/mol |
| Exact Mass | 306.27 |
| IUPAC Name | [(6E)-8-cyclohexylocta-1,6-dien-3-yl]-triethylsilane |
| SMILES | C=CC(CC/C=C/CC1CCCCC1)[Si](CC)(CC)CC |
| InChI | InChI=1S/C20H38Si/c1-5-20(21(6-2,7-3)8-4)18-14-10-13-17-19-15-11-9-12-16-19/h5,10,13,19-20H,1,6-9,11-12,14-18H2,2-4H3/b13-10+ |
| InChIKey | UUIHIJWZLHYJCY-JLHYYAGUSA-N |
| XLogP | 7.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.61 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|