C13H24Si — CID 134993439
[(1S,8aR)-1,2,3,5,6,7,8,8a-octahydronaphthalen-1-yl]-trimethylsilane (PubChem CID 134993439) has the molecular formula C13H24Si and a molecular weight of 208.42 g/mol. Its IUPAC name is [(1S,8aR)-1,2,3,5,6,7,8,8a-octahydronaphthalen-1-yl]-trimethylsilane.
| Compound Name | [(1S,8aR)-1,2,3,5,6,7,8,8a-octahydronaphthalen-1-yl]-trimethylsilane |
|---|---|
| PubChem CID | 134993439 |
| Molecular Formula | C13H24Si |
| Molecular Weight | 208.42 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | [(1S,8aR)-1,2,3,5,6,7,8,8a-octahydronaphthalen-1-yl]-trimethylsilane |
| SMILES | C[Si](C)(C)[C@H]1CCC=C2CCCC[C@H]21 |
| InChI | InChI=1S/C13H24Si/c1-14(2,3)13-10-6-8-11-7-4-5-9-12(11)13/h8,12-13H,4-7,9-10H2,1-3H3/t12-,13+/m1/s1 |
| InChIKey | JOFHZRCANWKHER-OLZOCXBDSA-N |
| XLogP | 4.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.42 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|