About 1-cyclohexylnona-1,2-dien-3-yl(trimethyl)silane
1-cyclohexylnona-1,2-dien-3-yl(trimethyl)silane (PubChem CID 10492903) has the molecular formula C18H34Si
and a molecular weight of 278.56 g/mol. Its IUPAC name is 1-cyclohexylnona-1,2-dien-3-yl(trimethyl)silane.
Molecular Properties
| Compound Name | 1-cyclohexylnona-1,2-dien-3-yl(trimethyl)silane |
| PubChem CID | 10492903 |
| Molecular Formula | C18H34Si |
| Molecular Weight | 278.56 g/mol |
| Exact Mass | 278.24 |
| IUPAC Name | 1-cyclohexylnona-1,2-dien-3-yl(trimethyl)silane |
| SMILES | CCCCCCC(=C=CC1CCCCC1)[Si](C)(C)C |
| InChI | InChI=1S/C18H34Si/c1-5-6-7-11-14-18(19(2,3)4)16-15-17-12-9-8-10-13-17/h15,17H,5-14H2,1-4H3 |
| InChIKey | RKKTYKRJBBTINT-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 278.56 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1-cyclohexylnona-1,2-dien-3-yl(trimethyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexylnona-1,2-dien-3-yl(trimethyl)silane?
The IUPAC name of 1-cyclohexylnona-1,2-dien-3-yl(trimethyl)silane (CID 10492903) is 1-cyclohexylnona-1,2-dien-3-yl(trimethyl)silane.
What is the SMILES notation for 1-cyclohexylnona-1,2-dien-3-yl(trimethyl)silane?
The canonical SMILES for 1-cyclohexylnona-1,2-dien-3-yl(trimethyl)silane is CCCCCCC(=C=CC1CCCCC1)[Si](C)(C)C.
What is the InChIKey of 1-cyclohexylnona-1,2-dien-3-yl(trimethyl)silane?
The InChIKey is RKKTYKRJBBTINT-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H34Si/c1-5-6-7-11-14-18(19(2,3)4)16-15-17-12-9-8-10-13-17/h15,17H,5-14H2,1-4H3.
What are the key properties of 1-cyclohexylnona-1,2-dien-3-yl(trimethyl)silane?
1-cyclohexylnona-1,2-dien-3-yl(trimethyl)silane has a molecular weight of 278.56 g/mol, XLogP of 6.50, 7 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexylnona-1,2-dien-3-yl(trimethyl)silane is sourced from PubChem (CID 10492903), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).