C24H50SiSn — CID 11317725
trimethyl-[(3Z,5R,7E)-5-methyl-8-tributylstannylocta-3,7-dien-3-yl]silane (PubChem CID 11317725) has the molecular formula C24H50SiSn and a molecular weight of 485.46 g/mol. Its IUPAC name is trimethyl-[(3Z,5R,7E)-5-methyl-8-tributylstannylocta-3,7-dien-3-yl]silane.
| Compound Name | trimethyl-[(3Z,5R,7E)-5-methyl-8-tributylstannylocta-3,7-dien-3-yl]silane |
|---|---|
| PubChem CID | 11317725 |
| Molecular Formula | C24H50SiSn |
| Molecular Weight | 485.46 g/mol |
| Exact Mass | 486.27 |
| IUPAC Name | trimethyl-[(3Z,5R,7E)-5-methyl-8-tributylstannylocta-3,7-dien-3-yl]silane |
| SMILES | CCCC[Sn](/C=C/C[C@@H](C)/C=C(/CC)[Si](C)(C)C)(CCCC)CCCC |
| InChI | InChI=1S/C12H23Si.3C4H9.Sn/c1-7-9-11(3)10-12(8-2)13(4,5)6;3*1-3-4-2;/h1,7,10-11H,8-9H2,2-6H3;3*1,3-4H2,2H3;/b7-1?,12-10-;;;;/t11-;;;;/m1..../s1 |
| InChIKey | LWJPWKHDNVMUGG-YNGBPTKVSA-N |
| XLogP | 9.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.46 |
| LogP ≤ 5 | 9.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|