C28H56Si4 — CID 102086635
(7E,18E)-1,1,3,3,12,12,14,14-octamethyl-2,13-dimethylidene-1,3,12,14-tetrasilacyclodocosa-7,18-diene (PubChem CID 102086635) has the molecular formula C28H56Si4 and a molecular weight of 505.10 g/mol. Its IUPAC name is (7E,18E)-1,1,3,3,12,12,14,14-octamethyl-2,13-dimethylidene-1,3,12,14-tetrasilacyclodocosa-7,18-diene.
| Compound Name | (7E,18E)-1,1,3,3,12,12,14,14-octamethyl-2,13-dimethylidene-1,3,12,14-tetrasilacyclodocosa-7,18-diene |
|---|---|
| PubChem CID | 102086635 |
| Molecular Formula | C28H56Si4 |
| Molecular Weight | 505.10 g/mol |
| Exact Mass | 504.35 |
| IUPAC Name | (7E,18E)-1,1,3,3,12,12,14,14-octamethyl-2,13-dimethylidene-1,3,12,14-tetrasilacyclodocosa-7,18-diene |
| SMILES | C=C1[Si](C)(C)CCC/C=C/CCC[Si](C)(C)C(=C)[Si](C)(C)CCC/C=C/CCC[Si]1(C)C |
| InChI | InChI=1S/C28H56Si4/c1-27-29(3,4)23-19-15-11-13-17-21-25-31(7,8)28(2)32(9,10)26-22-18-14-12-16-20-24-30(27,5)6/h11-14H,1-2,15-26H2,3-10H3/b13-11+,14-12+ |
| InChIKey | UEHBZGFSSDBDJI-PHEQNACWSA-N |
| XLogP | 10.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.10 |
| LogP ≤ 5 | 10.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|