C12H18Si — CID 134860399
[(1R,6S)-7-bicyclo[4.2.1]nona-2,4,7-trienyl]-trimethylsilane (PubChem CID 134860399) has the molecular formula C12H18Si and a molecular weight of 190.36 g/mol. Its IUPAC name is [(1R,6S)-7-bicyclo[4.2.1]nona-2,4,7-trienyl]-trimethylsilane.
| Compound Name | [(1R,6S)-7-bicyclo[4.2.1]nona-2,4,7-trienyl]-trimethylsilane |
|---|---|
| PubChem CID | 134860399 |
| Molecular Formula | C12H18Si |
| Molecular Weight | 190.36 g/mol |
| Exact Mass | 190.12 |
| IUPAC Name | [(1R,6S)-7-bicyclo[4.2.1]nona-2,4,7-trienyl]-trimethylsilane |
| SMILES | C[Si](C)(C)C1=C[C@H]2C=CC=C[C@@H]1C2 |
| InChI | InChI=1S/C12H18Si/c1-13(2,3)12-9-10-6-4-5-7-11(12)8-10/h4-7,9-11H,8H2,1-3H3/t10-,11+/m0/s1 |
| InChIKey | ATXWDWJRHWOVFQ-WDEREUQCSA-N |
| XLogP | 3.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.36 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|