C9H13Si — CID 22335962
2-dimethylsilylbicyclo[2.2.1]hept-2,5-diene (PubChem CID 22335962) has the molecular formula C9H13Si and a molecular weight of 149.29 g/mol.
| Compound Name | 2-dimethylsilylbicyclo[2.2.1]hept-2,5-diene |
|---|---|
| PubChem CID | 22335962 |
| Molecular Formula | C9H13Si |
| Molecular Weight | 149.29 g/mol |
| Exact Mass | 149.08 |
| IUPAC Name | — |
| SMILES | C[Si](C)C1=CC2C=CC1C2 |
| InChI | InChI=1S/C9H13Si/c1-10(2)9-6-7-3-4-8(9)5-7/h3-4,6-8H,5H2,1-2H3 |
| InChIKey | NBBOLZZRHKUFIL-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.29 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|