C10H18Si — CID 134991920
[(1R,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]-trimethylsilane (PubChem CID 134991920) has the molecular formula C10H18Si and a molecular weight of 166.34 g/mol. Its IUPAC name is [(1R,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]-trimethylsilane.
| Compound Name | [(1R,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]-trimethylsilane |
|---|---|
| PubChem CID | 134991920 |
| Molecular Formula | C10H18Si |
| Molecular Weight | 166.34 g/mol |
| Exact Mass | 166.12 |
| IUPAC Name | [(1R,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]-trimethylsilane |
| SMILES | C[Si](C)(C)[C@H]1C[C@@H]2C=C[C@H]1C2 |
| InChI | InChI=1S/C10H18Si/c1-11(2,3)10-7-8-4-5-9(10)6-8/h4-5,8-10H,6-7H2,1-3H3/t8-,9+,10+/m1/s1 |
| InChIKey | KVYAQQCJQHSQOE-UTLUCORTSA-N |
| XLogP | 3.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.34 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|