C7H9F3Si — CID 134992014
[(1R,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]-trifluorosilane (PubChem CID 134992014) has the molecular formula C7H9F3Si and a molecular weight of 178.23 g/mol. Its IUPAC name is [(1R,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]-trifluorosilane.
| Compound Name | [(1R,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]-trifluorosilane |
|---|---|
| PubChem CID | 134992014 |
| Molecular Formula | C7H9F3Si |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.04 |
| IUPAC Name | [(1R,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]-trifluorosilane |
| SMILES | F[Si](F)(F)[C@H]1C[C@@H]2C=C[C@H]1C2 |
| InChI | InChI=1S/C7H9F3Si/c8-11(9,10)7-4-5-1-2-6(7)3-5/h1-2,5-7H,3-4H2/t5-,6+,7+/m1/s1 |
| InChIKey | KAVMOGBCKRXUMG-VQVTYTSYSA-N |
| XLogP | 2.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|