C13H22Cl2Si2 — CID 548736
2-bicyclo[2.2.1]hepta-2,5-dienyl-dichloro-(3-trimethylsilylpropyl)silane (PubChem CID 548736) has the molecular formula C13H22Cl2Si2 and a molecular weight of 305.40 g/mol. Its IUPAC name is 2-bicyclo[2.2.1]hepta-2,5-dienyl-dichloro-(3-trimethylsilylpropyl)silane.
| Compound Name | 2-bicyclo[2.2.1]hepta-2,5-dienyl-dichloro-(3-trimethylsilylpropyl)silane |
|---|---|
| PubChem CID | 548736 |
| Molecular Formula | C13H22Cl2Si2 |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | 2-bicyclo[2.2.1]hepta-2,5-dienyl-dichloro-(3-trimethylsilylpropyl)silane |
| SMILES | C[Si](C)(C)CCC[Si](Cl)(Cl)C1=CC2C=CC1C2 |
| InChI | InChI=1S/C13H22Cl2Si2/c1-16(2,3)7-4-8-17(14,15)13-10-11-5-6-12(13)9-11/h5-6,10-12H,4,7-9H2,1-3H3 |
| InChIKey | SSIYTTBOYCOPAA-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|