C26H44Cl2OSi4 — CID 552310
2-bicyclo[2.2.1]hepta-2,5-dienyl-[2-bicyclo[2.2.1]hepta-2,5-dienyl-chloro-(3-trimethylsilylpropyl)silyl]oxy-chloro-(3-trimethylsilylpropyl)silane (PubChem CID 552310) has the molecular formula C26H44Cl2OSi4 and a molecular weight of 555.89 g/mol. Its IUPAC name is 2-bicyclo[2.2.1]hepta-2,5-dienyl-[2-bicyclo[2.2.1]hepta-2,5-dienyl-chloro-(3-trimethylsilylpropyl)silyl]oxy-chloro-(3-trimethylsilylpropyl)silane.
| Compound Name | 2-bicyclo[2.2.1]hepta-2,5-dienyl-[2-bicyclo[2.2.1]hepta-2,5-dienyl-chloro-(3-trimethylsilylpropyl)silyl]oxy-chloro-(3-trimethylsilylpropyl)silane |
|---|---|
| PubChem CID | 552310 |
| Molecular Formula | C26H44Cl2OSi4 |
| Molecular Weight | 555.89 g/mol |
| Exact Mass | 554.18 |
| IUPAC Name | 2-bicyclo[2.2.1]hepta-2,5-dienyl-[2-bicyclo[2.2.1]hepta-2,5-dienyl-chloro-(3-trimethylsilylpropyl)silyl]oxy-chloro-(3-trimethylsilylpropyl)silane |
| SMILES | C[Si](C)(C)CCC[Si](Cl)(O[Si](Cl)(CCC[Si](C)(C)C)C1=CC2C=CC1C2)C1=CC2C=CC1C2 |
| InChI | InChI=1S/C26H44Cl2OSi4/c1-30(2,3)13-7-15-32(27,25-19-21-9-11-23(25)17-21)29-33(28,16-8-14-31(4,5)6)26-20-22-10-12-24(26)18-22/h9-12,19-24H,7-8,13-18H2,1-6H3 |
| InChIKey | ZJWKVBSLXUAWAT-UHFFFAOYSA-N |
| XLogP | 9.16 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.89 |
| LogP ≤ 5 | 9.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|