C7H8S — CID 121485650
bicyclo[2.2.1]hepta-2,5-diene-2-thiol (PubChem CID 121485650) has the molecular formula C7H8S and a molecular weight of 124.21 g/mol. Its IUPAC name is bicyclo[2.2.1]hepta-2,5-diene-2-thiol.
| Compound Name | bicyclo[2.2.1]hepta-2,5-diene-2-thiol |
|---|---|
| PubChem CID | 121485650 |
| Molecular Formula | C7H8S |
| Molecular Weight | 124.21 g/mol |
| Exact Mass | 124.03 |
| IUPAC Name | bicyclo[2.2.1]hepta-2,5-diene-2-thiol |
| SMILES | SC1=CC2C=CC1C2 |
| InChI | InChI=1S/C7H8S/c8-7-4-5-1-2-6(7)3-5/h1-2,4-6,8H,3H2 |
| InChIKey | ZONOKOSOZBVCQF-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 124.21 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|