C10H12 — CID 173026536
2-[(Z)-prop-1-enyl]bicyclo[2.2.1]hepta-2,5-diene (PubChem CID 173026536) has the molecular formula C10H12 and a molecular weight of 132.21 g/mol. Its IUPAC name is 2-[(Z)-prop-1-enyl]bicyclo[2.2.1]hepta-2,5-diene.
| Compound Name | 2-[(Z)-prop-1-enyl]bicyclo[2.2.1]hepta-2,5-diene |
|---|---|
| PubChem CID | 173026536 |
| Molecular Formula | C10H12 |
| Molecular Weight | 132.21 g/mol |
| Exact Mass | 132.09 |
| IUPAC Name | 2-[(Z)-prop-1-enyl]bicyclo[2.2.1]hepta-2,5-diene |
| SMILES | C/C=C\C1=CC2C=CC1C2 |
| InChI | InChI=1S/C10H12/c1-2-3-9-6-8-4-5-10(9)7-8/h2-6,8,10H,7H2,1H3/b3-2- |
| InChIKey | YYBDEBBSYQNIDZ-IHWYPQMZSA-N |
| XLogP | 2.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.21 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|