C12H16O2 — CID 22754185
butyl bicyclo[2.2.1]hepta-2,5-diene-2-carboxylate (PubChem CID 22754185) has the molecular formula C12H16O2 and a molecular weight of 192.26 g/mol. Its IUPAC name is butyl bicyclo[2.2.1]hepta-2,5-diene-2-carboxylate.
| Compound Name | butyl bicyclo[2.2.1]hepta-2,5-diene-2-carboxylate |
|---|---|
| PubChem CID | 22754185 |
| Molecular Formula | C12H16O2 |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.12 |
| IUPAC Name | butyl bicyclo[2.2.1]hepta-2,5-diene-2-carboxylate |
| SMILES | CCCCOC(=O)C1=CC2C=CC1C2 |
| InChI | InChI=1S/C12H16O2/c1-2-3-6-14-12(13)11-8-9-4-5-10(11)7-9/h4-5,8-10H,2-3,6-7H2,1H3 |
| InChIKey | LGZKEXCMYAFYIB-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|