C12H19N — CID 123440293
N-(5-methyl-2-prop-1-enylcyclohex-2-en-1-yl)ethanimine (PubChem CID 123440293) has the molecular formula C12H19N and a molecular weight of 177.29 g/mol. Its IUPAC name is N-(5-methyl-2-prop-1-enylcyclohex-2-en-1-yl)ethanimine.
| Compound Name | N-(5-methyl-2-prop-1-enylcyclohex-2-en-1-yl)ethanimine |
|---|---|
| PubChem CID | 123440293 |
| Molecular Formula | C12H19N |
| Molecular Weight | 177.29 g/mol |
| Exact Mass | 177.15 |
| IUPAC Name | N-(5-methyl-2-prop-1-enylcyclohex-2-en-1-yl)ethanimine |
| SMILES | CC=CC1=CCC(C)CC1/N=C/C |
| InChI | InChI=1S/C12H19N/c1-4-6-11-8-7-10(3)9-12(11)13-5-2/h4-6,8,10,12H,7,9H2,1-3H3/b6-4?,13-5+ |
| InChIKey | WAJKLLBUCAEQTM-DKGHMGHDSA-N |
| XLogP | 3.38 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.29 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|