C16H14O3 — CID 129093280
8-(2-bicyclo[2.2.1]hepta-2,5-dienyl)-4-oxatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (PubChem CID 129093280) has the molecular formula C16H14O3 and a molecular weight of 254.28 g/mol. Its IUPAC name is 8-(2-bicyclo[2.2.1]hepta-2,5-dienyl)-4-oxatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
| Compound Name | 8-(2-bicyclo[2.2.1]hepta-2,5-dienyl)-4-oxatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 129093280 |
| Molecular Formula | C16H14O3 |
| Molecular Weight | 254.28 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | 8-(2-bicyclo[2.2.1]hepta-2,5-dienyl)-4-oxatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| SMILES | O=C1OC(=O)C2C3CC(C=C3C3=CC4C=CC3C4)C12 |
| InChI | InChI=1S/C16H14O3/c17-15-13-9-5-11(10-4-7-1-2-8(10)3-7)12(6-9)14(13)16(18)19-15/h1-2,4-5,7-9,12-14H,3,6H2 |
| InChIKey | XSGHAEKJNGUKPY-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.28 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|