C16H29ClOSi2 — CID 10373638
[1-(4-chlorophenyl)-4-trimethylsilylbutoxy]-trimethylsilane (PubChem CID 10373638) has the molecular formula C16H29ClOSi2 and a molecular weight of 329.03 g/mol. Its IUPAC name is [1-(4-chlorophenyl)-4-trimethylsilylbutoxy]-trimethylsilane.
| Compound Name | [1-(4-chlorophenyl)-4-trimethylsilylbutoxy]-trimethylsilane |
|---|---|
| PubChem CID | 10373638 |
| Molecular Formula | C16H29ClOSi2 |
| Molecular Weight | 329.03 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | [1-(4-chlorophenyl)-4-trimethylsilylbutoxy]-trimethylsilane |
| SMILES | C[Si](C)(C)CCCC(O[Si](C)(C)C)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H29ClOSi2/c1-19(2,3)13-7-8-16(18-20(4,5)6)14-9-11-15(17)12-10-14/h9-12,16H,7-8,13H2,1-6H3 |
| InChIKey | NKDFYMYNPLPROK-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.03 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|