C24H39ClO2Si — CID 102457673
(3S)-3-[4-[tert-butyl(dimethyl)silyl]oxy-4-(4-chlorophenyl)butyl]-4,4-dimethylcyclohexan-1-one (PubChem CID 102457673) has the molecular formula C24H39ClO2Si and a molecular weight of 423.11 g/mol. Its IUPAC name is (3S)-3-[4-[tert-butyl(dimethyl)silyl]oxy-4-(4-chlorophenyl)butyl]-4,4-dimethylcyclohexan-1-one.
| Compound Name | (3S)-3-[4-[tert-butyl(dimethyl)silyl]oxy-4-(4-chlorophenyl)butyl]-4,4-dimethylcyclohexan-1-one |
|---|---|
| PubChem CID | 102457673 |
| Molecular Formula | C24H39ClO2Si |
| Molecular Weight | 423.11 g/mol |
| Exact Mass | 422.24 |
| IUPAC Name | (3S)-3-[4-[tert-butyl(dimethyl)silyl]oxy-4-(4-chlorophenyl)butyl]-4,4-dimethylcyclohexan-1-one |
| SMILES | CC1(C)CCC(=O)C[C@@H]1CCCC(O[Si](C)(C)C(C)(C)C)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H39ClO2Si/c1-23(2,3)28(6,7)27-22(18-11-13-20(25)14-12-18)10-8-9-19-17-21(26)15-16-24(19,4)5/h11-14,19,22H,8-10,15-17H2,1-7H3/t19-,22?/m0/s1 |
| InChIKey | PIPGRSJPKCYPOT-YDNXMHBPSA-N |
| XLogP | 7.97 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.11 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|