C25H52Si4 — CID 597990
2-bicyclo[2.2.1]hepta-2,5-dienyl-tris(3-trimethylsilylpropyl)silane (PubChem CID 597990) has the molecular formula C25H52Si4 and a molecular weight of 465.04 g/mol. Its IUPAC name is 2-bicyclo[2.2.1]hepta-2,5-dienyl-tris(3-trimethylsilylpropyl)silane.
| Compound Name | 2-bicyclo[2.2.1]hepta-2,5-dienyl-tris(3-trimethylsilylpropyl)silane |
|---|---|
| PubChem CID | 597990 |
| Molecular Formula | C25H52Si4 |
| Molecular Weight | 465.04 g/mol |
| Exact Mass | 464.31 |
| IUPAC Name | 2-bicyclo[2.2.1]hepta-2,5-dienyl-tris(3-trimethylsilylpropyl)silane |
| SMILES | C[Si](C)(C)CCC[Si](CCC[Si](C)(C)C)(CCC[Si](C)(C)C)C1=CC2C=CC1C2 |
| InChI | InChI=1S/C25H52Si4/c1-26(2,3)15-10-18-29(19-11-16-27(4,5)6,20-12-17-28(7,8)9)25-22-23-13-14-24(25)21-23/h13-14,22-24H,10-12,15-21H2,1-9H3 |
| InChIKey | ZKMDYEOMPZEWSX-UHFFFAOYSA-N |
| XLogP | 9.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.04 |
| LogP ≤ 5 | 9.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|