C17H30PtSi2 — CID 134888512
bicyclo[2.2.1]hepta-2,5-diene;bis(ethenyl-methanidyl-dimethylsilane);platinum(2+) (PubChem CID 134888512) has the molecular formula C17H30PtSi2 and a molecular weight of 485.68 g/mol. Its IUPAC name is bicyclo[2.2.1]hepta-2,5-diene;bis(ethenyl-methanidyl-dimethylsilane);platinum(2+).
| Compound Name | bicyclo[2.2.1]hepta-2,5-diene;bis(ethenyl-methanidyl-dimethylsilane);platinum(2+) |
|---|---|
| PubChem CID | 134888512 |
| Molecular Formula | C17H30PtSi2 |
| Molecular Weight | 485.68 g/mol |
| Exact Mass | 485.15 |
| IUPAC Name | bicyclo[2.2.1]hepta-2,5-diene;bis(ethenyl-methanidyl-dimethylsilane);platinum(2+) |
| SMILES | C1=CC2C=CC1C2.C=C[Si]([CH2-])(C)C.C=C[Si]([CH2-])(C)C.[Pt+2] |
| InChI | InChI=1S/C7H8.2C5H11Si.Pt/c1-2-7-4-3-6(1)5-7;2*1-5-6(2,3)4;/h1-4,6-7H,5H2;2*5H,1-2H2,3-4H3;/q;2*-1;+2 |
| InChIKey | DQHCBNPCUCXRNX-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.68 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|