C19H37ClSi3 — CID 548735
2-bicyclo[2.2.1]hepta-2,5-dienyl-chloro-bis(3-trimethylsilylpropyl)silane (PubChem CID 548735) has the molecular formula C19H37ClSi3 and a molecular weight of 385.22 g/mol. Its IUPAC name is 2-bicyclo[2.2.1]hepta-2,5-dienyl-chloro-bis(3-trimethylsilylpropyl)silane.
| Compound Name | 2-bicyclo[2.2.1]hepta-2,5-dienyl-chloro-bis(3-trimethylsilylpropyl)silane |
|---|---|
| PubChem CID | 548735 |
| Molecular Formula | C19H37ClSi3 |
| Molecular Weight | 385.22 g/mol |
| Exact Mass | 384.19 |
| IUPAC Name | 2-bicyclo[2.2.1]hepta-2,5-dienyl-chloro-bis(3-trimethylsilylpropyl)silane |
| SMILES | C[Si](C)(C)CCC[Si](Cl)(CCC[Si](C)(C)C)C1=CC2C=CC1C2 |
| InChI | InChI=1S/C19H37ClSi3/c1-21(2,3)11-7-13-23(20,14-8-12-22(4,5)6)19-16-17-9-10-18(19)15-17/h9-10,16-18H,7-8,11-15H2,1-6H3 |
| InChIKey | CUEYHJBANMSYKE-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.22 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|