C28H48Si — CID 139174999
bis[(1R)-2,4-ditert-butylcyclopenta-2,4-dien-1-yl]-dimethylsilane (PubChem CID 139174999) has the molecular formula C28H48Si and a molecular weight of 412.78 g/mol. Its IUPAC name is bis[(1R)-2,4-ditert-butylcyclopenta-2,4-dien-1-yl]-dimethylsilane.
| Compound Name | bis[(1R)-2,4-ditert-butylcyclopenta-2,4-dien-1-yl]-dimethylsilane |
|---|---|
| PubChem CID | 139174999 |
| Molecular Formula | C28H48Si |
| Molecular Weight | 412.78 g/mol |
| Exact Mass | 412.35 |
| IUPAC Name | bis[(1R)-2,4-ditert-butylcyclopenta-2,4-dien-1-yl]-dimethylsilane |
| SMILES | CC(C)(C)C1=C[C@@H]([Si](C)(C)[C@@H]2C=C(C(C)(C)C)C=C2C(C)(C)C)C(C(C)(C)C)=C1 |
| InChI | InChI=1S/C28H48Si/c1-25(2,3)19-15-21(27(7,8)9)23(17-19)29(13,14)24-18-20(26(4,5)6)16-22(24)28(10,11)12/h15-18,23-24H,1-14H3/t23-,24-/m1/s1 |
| InChIKey | NDGWJONILSEQEH-DNQXCXABSA-N |
| XLogP | 9.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.78 |
| LogP ≤ 5 | 9.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|