C26H48Si3 — CID 12983335
bis(4-tert-butyl-2-trimethylsilylcyclopenta-2,4-dien-1-yl)-dimethylsilane (PubChem CID 12983335) has the molecular formula C26H48Si3 and a molecular weight of 444.93 g/mol. Its IUPAC name is bis(4-tert-butyl-2-trimethylsilylcyclopenta-2,4-dien-1-yl)-dimethylsilane.
| Compound Name | bis(4-tert-butyl-2-trimethylsilylcyclopenta-2,4-dien-1-yl)-dimethylsilane |
|---|---|
| PubChem CID | 12983335 |
| Molecular Formula | C26H48Si3 |
| Molecular Weight | 444.93 g/mol |
| Exact Mass | 444.31 |
| IUPAC Name | bis(4-tert-butyl-2-trimethylsilylcyclopenta-2,4-dien-1-yl)-dimethylsilane |
| SMILES | CC(C)(C)C1=CC([Si](C)(C)C2C=C(C(C)(C)C)C=C2[Si](C)(C)C)C([Si](C)(C)C)=C1 |
| InChI | InChI=1S/C26H48Si3/c1-25(2,3)19-15-21(27(7,8)9)23(17-19)29(13,14)24-18-20(26(4,5)6)16-22(24)28(10,11)12/h15-18,23-24H,1-14H3 |
| InChIKey | OEIUZEJKHDULLT-UHFFFAOYSA-N |
| XLogP | 9.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.93 |
| LogP ≤ 5 | 9.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|