C18H32Si2 — CID 553792
trimethyl-[2-(2-methylprop-1-enyl)-1-trimethylsilyl-5,6-dihydro-4H-pentalen-2-yl]silane (PubChem CID 553792) has the molecular formula C18H32Si2 and a molecular weight of 304.63 g/mol. Its IUPAC name is trimethyl-[2-(2-methylprop-1-enyl)-1-trimethylsilyl-5,6-dihydro-4H-pentalen-2-yl]silane.
| Compound Name | trimethyl-[2-(2-methylprop-1-enyl)-1-trimethylsilyl-5,6-dihydro-4H-pentalen-2-yl]silane |
|---|---|
| PubChem CID | 553792 |
| Molecular Formula | C18H32Si2 |
| Molecular Weight | 304.63 g/mol |
| Exact Mass | 304.20 |
| IUPAC Name | trimethyl-[2-(2-methylprop-1-enyl)-1-trimethylsilyl-5,6-dihydro-4H-pentalen-2-yl]silane |
| SMILES | CC(C)=CC1([Si](C)(C)C)C=C2CCCC2=C1[Si](C)(C)C |
| InChI | InChI=1S/C18H32Si2/c1-14(2)12-18(20(6,7)8)13-15-10-9-11-16(15)17(18)19(3,4)5/h12-13H,9-11H2,1-8H3 |
| InChIKey | ANXFUYWFSVISFP-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.63 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|