C20H32Si — CID 11001089
bis(3-tert-butylcyclopenta-2,4-dien-1-yl)-dimethylsilane (PubChem CID 11001089) has the molecular formula C20H32Si and a molecular weight of 300.56 g/mol. Its IUPAC name is bis(3-tert-butylcyclopenta-2,4-dien-1-yl)-dimethylsilane.
| Compound Name | bis(3-tert-butylcyclopenta-2,4-dien-1-yl)-dimethylsilane |
|---|---|
| PubChem CID | 11001089 |
| Molecular Formula | C20H32Si |
| Molecular Weight | 300.56 g/mol |
| Exact Mass | 300.23 |
| IUPAC Name | bis(3-tert-butylcyclopenta-2,4-dien-1-yl)-dimethylsilane |
| SMILES | CC(C)(C)C1=CC([Si](C)(C)C2C=CC(C(C)(C)C)=C2)C=C1 |
| InChI | InChI=1S/C20H32Si/c1-19(2,3)15-9-11-17(13-15)21(7,8)18-12-10-16(14-18)20(4,5)6/h9-14,17-18H,1-8H3 |
| InChIKey | ANJHTOUUADABQR-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.56 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|