C19H30Si — CID 139067482
[(3E)-3-(2,4-ditert-butylcyclopenta-2,4-dien-1-ylidene)prop-1-ynyl]-trimethylsilane (PubChem CID 139067482) has the molecular formula C19H30Si and a molecular weight of 286.53 g/mol. Its IUPAC name is [(3E)-3-(2,4-ditert-butylcyclopenta-2,4-dien-1-ylidene)prop-1-ynyl]-trimethylsilane.
| Compound Name | [(3E)-3-(2,4-ditert-butylcyclopenta-2,4-dien-1-ylidene)prop-1-ynyl]-trimethylsilane |
|---|---|
| PubChem CID | 139067482 |
| Molecular Formula | C19H30Si |
| Molecular Weight | 286.53 g/mol |
| Exact Mass | 286.21 |
| IUPAC Name | [(3E)-3-(2,4-ditert-butylcyclopenta-2,4-dien-1-ylidene)prop-1-ynyl]-trimethylsilane |
| SMILES | CC(C)(C)C1=C/C(=C\C#C[Si](C)(C)C)C(C(C)(C)C)=C1 |
| InChI | InChI=1S/C19H30Si/c1-18(2,3)16-13-15(11-10-12-20(7,8)9)17(14-16)19(4,5)6/h11,13-14H,1-9H3/b15-11+ |
| InChIKey | GLEQSBNDGRIPCW-RVDMUPIBSA-N |
| XLogP | 5.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.53 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|