C26H44Si — CID 139672560
bis[2,4-di(propan-2-yl)cyclopenta-2,4-dien-1-yl]-diethylsilane (PubChem CID 139672560) has the molecular formula C26H44Si and a molecular weight of 384.72 g/mol. Its IUPAC name is bis[2,4-di(propan-2-yl)cyclopenta-2,4-dien-1-yl]-diethylsilane.
| Compound Name | bis[2,4-di(propan-2-yl)cyclopenta-2,4-dien-1-yl]-diethylsilane |
|---|---|
| PubChem CID | 139672560 |
| Molecular Formula | C26H44Si |
| Molecular Weight | 384.72 g/mol |
| Exact Mass | 384.32 |
| IUPAC Name | bis[2,4-di(propan-2-yl)cyclopenta-2,4-dien-1-yl]-diethylsilane |
| SMILES | CC[Si](CC)(C1C=C(C(C)C)C=C1C(C)C)C1C=C(C(C)C)C=C1C(C)C |
| InChI | InChI=1S/C26H44Si/c1-11-27(12-2,25-15-21(17(3)4)13-23(25)19(7)8)26-16-22(18(5)6)14-24(26)20(9)10/h13-20,25-26H,11-12H2,1-10H3 |
| InChIKey | YLCANNMGGSVZDD-UHFFFAOYSA-N |
| XLogP | 8.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.72 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|