C20H41BSiSn — CID 634639
[4-diethylboranyl-3-ethyl-1,1-dimethyl-5-(3-methylbutyl)silol-2-yl]-trimethylstannane (PubChem CID 634639) has the molecular formula C20H41BSiSn and a molecular weight of 439.16 g/mol. Its IUPAC name is [4-diethylboranyl-3-ethyl-1,1-dimethyl-5-(3-methylbutyl)silol-2-yl]-trimethylstannane.
| Compound Name | [4-diethylboranyl-3-ethyl-1,1-dimethyl-5-(3-methylbutyl)silol-2-yl]-trimethylstannane |
|---|---|
| PubChem CID | 634639 |
| Molecular Formula | C20H41BSiSn |
| Molecular Weight | 439.16 g/mol |
| Exact Mass | 440.21 |
| IUPAC Name | [4-diethylboranyl-3-ethyl-1,1-dimethyl-5-(3-methylbutyl)silol-2-yl]-trimethylstannane |
| SMILES | CCB(CC)C1=C(CCC(C)C)[Si](C)(C)C([Sn](C)(C)C)=C1CC |
| InChI | InChI=1S/C17H32BSi.3CH3.Sn/c1-8-15-13-19(6,7)16(12-11-14(4)5)17(15)18(9-2)10-3;;;;/h14H,8-12H2,1-7H3;3*1H3; |
| InChIKey | QEYAGSSJVKYKJQ-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.16 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|