C36H70B2Si2Sn — CID 15495139
bis[4-diethylboranyl-3-ethyl-1,1-dimethyl-5-(3-methylbutyl)silol-2-yl]-dimethylstannane (PubChem CID 15495139) has the molecular formula C36H70B2Si2Sn and a molecular weight of 699.46 g/mol. Its IUPAC name is bis[4-diethylboranyl-3-ethyl-1,1-dimethyl-5-(3-methylbutyl)silol-2-yl]-dimethylstannane.
| Compound Name | bis[4-diethylboranyl-3-ethyl-1,1-dimethyl-5-(3-methylbutyl)silol-2-yl]-dimethylstannane |
|---|---|
| PubChem CID | 15495139 |
| Molecular Formula | C36H70B2Si2Sn |
| Molecular Weight | 699.46 g/mol |
| Exact Mass | 700.42 |
| IUPAC Name | bis[4-diethylboranyl-3-ethyl-1,1-dimethyl-5-(3-methylbutyl)silol-2-yl]-dimethylstannane |
| SMILES | CCB(CC)C1=C(CCC(C)C)[Si](C)(C)C([Sn](C)(C)C2=C(CC)C(B(CC)CC)=C(CCC(C)C)[Si]2(C)C)=C1CC |
| InChI | InChI=1S/2C17H32BSi.2CH3.Sn/c2*1-8-15-13-19(6,7)16(12-11-14(4)5)17(15)18(9-2)10-3;;;/h2*14H,8-12H2,1-7H3;2*1H3; |
| InChIKey | XYBFTWPESQRDFF-UHFFFAOYSA-N |
| XLogP | 12.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.46 |
| LogP ≤ 5 | 12.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|