C17H33BSi — CID 177411032
diethyl-[4-ethyl-1,1-dimethyl-5-(3-methylbutyl)silol-3-yl]borane (PubChem CID 177411032) has the molecular formula C17H33BSi and a molecular weight of 276.35 g/mol. Its IUPAC name is diethyl-[4-ethyl-1,1-dimethyl-5-(3-methylbutyl)silol-3-yl]borane.
| Compound Name | diethyl-[4-ethyl-1,1-dimethyl-5-(3-methylbutyl)silol-3-yl]borane |
|---|---|
| PubChem CID | 177411032 |
| Molecular Formula | C17H33BSi |
| Molecular Weight | 276.35 g/mol |
| Exact Mass | 276.24 |
| IUPAC Name | diethyl-[4-ethyl-1,1-dimethyl-5-(3-methylbutyl)silol-3-yl]borane |
| SMILES | CCB(CC)C1=C[Si](C)(C)C(CCC(C)C)=C1CC |
| InChI | InChI=1S/C17H33BSi/c1-8-15-16(18(9-2)10-3)13-19(6,7)17(15)12-11-14(4)5/h13-14H,8-12H2,1-7H3 |
| InChIKey | NYATUGUZMHPIOI-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.35 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|