C20H38Si — CID 91244741
trimethyl-[2,3,4,5-tetra(propan-2-yl)cyclopenta-2,4-dien-1-yl]silane (PubChem CID 91244741) has the molecular formula C20H38Si and a molecular weight of 306.61 g/mol. Its IUPAC name is trimethyl-[2,3,4,5-tetra(propan-2-yl)cyclopenta-2,4-dien-1-yl]silane.
| Compound Name | trimethyl-[2,3,4,5-tetra(propan-2-yl)cyclopenta-2,4-dien-1-yl]silane |
|---|---|
| PubChem CID | 91244741 |
| Molecular Formula | C20H38Si |
| Molecular Weight | 306.61 g/mol |
| Exact Mass | 306.27 |
| IUPAC Name | trimethyl-[2,3,4,5-tetra(propan-2-yl)cyclopenta-2,4-dien-1-yl]silane |
| SMILES | CC(C)C1=C(C(C)C)C([Si](C)(C)C)C(C(C)C)=C1C(C)C |
| InChI | InChI=1S/C20H38Si/c1-12(2)16-17(13(3)4)19(15(7)8)20(21(9,10)11)18(16)14(5)6/h12-15,20H,1-11H3 |
| InChIKey | IKXLXOMONLIOCQ-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.61 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|