C30H52Si — CID 139672569
di(butan-2-yl)-bis[2,4-di(propan-2-yl)cyclopenta-2,4-dien-1-yl]silane (PubChem CID 139672569) has the molecular formula C30H52Si and a molecular weight of 440.83 g/mol. Its IUPAC name is di(butan-2-yl)-bis[2,4-di(propan-2-yl)cyclopenta-2,4-dien-1-yl]silane.
| Compound Name | di(butan-2-yl)-bis[2,4-di(propan-2-yl)cyclopenta-2,4-dien-1-yl]silane |
|---|---|
| PubChem CID | 139672569 |
| Molecular Formula | C30H52Si |
| Molecular Weight | 440.83 g/mol |
| Exact Mass | 440.38 |
| IUPAC Name | di(butan-2-yl)-bis[2,4-di(propan-2-yl)cyclopenta-2,4-dien-1-yl]silane |
| SMILES | CCC(C)[Si](C(C)CC)(C1C=C(C(C)C)C=C1C(C)C)C1C=C(C(C)C)C=C1C(C)C |
| InChI | InChI=1S/C30H52Si/c1-13-23(11)31(24(12)14-2,29-17-25(19(3)4)15-27(29)21(7)8)30-18-26(20(5)6)16-28(30)22(9)10/h15-24,29-30H,13-14H2,1-12H3 |
| InChIKey | OLZKRMVWPPXFPY-UHFFFAOYSA-N |
| XLogP | 10.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.83 |
| LogP ≤ 5 | 10.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|