C21H33BrSi — CID 134901598
bromo-methyl-bis(1,2,3,4,5-pentamethylcyclopenta-2,4-dien-1-yl)silane (PubChem CID 134901598) has the molecular formula C21H33BrSi and a molecular weight of 393.49 g/mol. Its IUPAC name is bromo-methyl-bis(1,2,3,4,5-pentamethylcyclopenta-2,4-dien-1-yl)silane.
| Compound Name | bromo-methyl-bis(1,2,3,4,5-pentamethylcyclopenta-2,4-dien-1-yl)silane |
|---|---|
| PubChem CID | 134901598 |
| Molecular Formula | C21H33BrSi |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | bromo-methyl-bis(1,2,3,4,5-pentamethylcyclopenta-2,4-dien-1-yl)silane |
| SMILES | CC1=C(C)C(C)([Si](C)(Br)C2(C)C(C)=C(C)C(C)=C2C)C(C)=C1C |
| InChI | InChI=1S/C21H33BrSi/c1-12-13(2)17(6)20(9,16(12)5)23(11,22)21(10)18(7)14(3)15(4)19(21)8/h1-11H3 |
| InChIKey | FXPYODJUYUZLJD-UHFFFAOYSA-N |
| XLogP | 7.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|