C14H27BSi — CID 5325132
diethyl-(4-ethyl-1,1,2,5-tetramethylsilol-3-yl)borane (PubChem CID 5325132) has the molecular formula C14H27BSi and a molecular weight of 234.27 g/mol. Its IUPAC name is diethyl-(4-ethyl-1,1,2,5-tetramethylsilol-3-yl)borane.
| Compound Name | diethyl-(4-ethyl-1,1,2,5-tetramethylsilol-3-yl)borane |
|---|---|
| PubChem CID | 5325132 |
| Molecular Formula | C14H27BSi |
| Molecular Weight | 234.27 g/mol |
| Exact Mass | 234.20 |
| IUPAC Name | diethyl-(4-ethyl-1,1,2,5-tetramethylsilol-3-yl)borane |
| SMILES | CCB(CC)C1=C(C)[Si](C)(C)C(C)=C1CC |
| InChI | InChI=1S/C14H27BSi/c1-8-13-11(4)16(6,7)12(5)14(13)15(9-2)10-3/h8-10H2,1-7H3 |
| InChIKey | GLYGWTQFAZXNJZ-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.27 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|