C19H36BClSi — CID 102279336
(2,5-dibutyl-1-chloro-4-ethyl-1-methylsilol-3-yl)-diethylborane (PubChem CID 102279336) has the molecular formula C19H36BClSi and a molecular weight of 338.85 g/mol. Its IUPAC name is (2,5-dibutyl-1-chloro-4-ethyl-1-methylsilol-3-yl)-diethylborane.
| Compound Name | (2,5-dibutyl-1-chloro-4-ethyl-1-methylsilol-3-yl)-diethylborane |
|---|---|
| PubChem CID | 102279336 |
| Molecular Formula | C19H36BClSi |
| Molecular Weight | 338.85 g/mol |
| Exact Mass | 338.24 |
| IUPAC Name | (2,5-dibutyl-1-chloro-4-ethyl-1-methylsilol-3-yl)-diethylborane |
| SMILES | CCCCC1=C(CC)C(B(CC)CC)=C(CCCC)[Si]1(C)Cl |
| InChI | InChI=1S/C19H36BClSi/c1-7-12-14-17-16(9-3)19(20(10-4)11-5)18(15-13-8-2)22(17,6)21/h7-15H2,1-6H3 |
| InChIKey | ADULJNDJRYWZEL-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.85 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|