C10H16Cl2Si — CID 11322281
dichloro-methyl-(2,3,4,5-tetramethylcyclopenta-2,4-dien-1-yl)silane (PubChem CID 11322281) has the molecular formula C10H16Cl2Si and a molecular weight of 235.23 g/mol. Its IUPAC name is dichloro-methyl-(2,3,4,5-tetramethylcyclopenta-2,4-dien-1-yl)silane.
| Compound Name | dichloro-methyl-(2,3,4,5-tetramethylcyclopenta-2,4-dien-1-yl)silane |
|---|---|
| PubChem CID | 11322281 |
| Molecular Formula | C10H16Cl2Si |
| Molecular Weight | 235.23 g/mol |
| Exact Mass | 234.04 |
| IUPAC Name | dichloro-methyl-(2,3,4,5-tetramethylcyclopenta-2,4-dien-1-yl)silane |
| SMILES | CC1=C(C)C([Si](C)(Cl)Cl)C(C)=C1C |
| InChI | InChI=1S/C10H16Cl2Si/c1-6-7(2)9(4)10(8(6)3)13(5,11)12/h10H,1-5H3 |
| InChIKey | DQKRUJVPQFPIFP-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.23 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|