C20H35BSi2Sn — CID 15495142
[3-diethylboranyl-4-ethyl-5-[ethynyl(dimethyl)silyl]-1,1-dimethylstannol-2-yl]-ethynyl-dimethylsilane (PubChem CID 15495142) has the molecular formula C20H35BSi2Sn and a molecular weight of 461.20 g/mol. Its IUPAC name is [3-diethylboranyl-4-ethyl-5-[ethynyl(dimethyl)silyl]-1,1-dimethylstannol-2-yl]-ethynyl-dimethylsilane.
| Compound Name | [3-diethylboranyl-4-ethyl-5-[ethynyl(dimethyl)silyl]-1,1-dimethylstannol-2-yl]-ethynyl-dimethylsilane |
|---|---|
| PubChem CID | 15495142 |
| Molecular Formula | C20H35BSi2Sn |
| Molecular Weight | 461.20 g/mol |
| Exact Mass | 462.14 |
| IUPAC Name | [3-diethylboranyl-4-ethyl-5-[ethynyl(dimethyl)silyl]-1,1-dimethylstannol-2-yl]-ethynyl-dimethylsilane |
| SMILES | C#C[Si](C)(C)C1=C(CC)C(B(CC)CC)=C([Si](C)(C)C#C)[Sn]1(C)C |
| InChI | InChI=1S/C18H29BSi2.2CH3.Sn/c1-10-17(15-20(6,7)13-4)18(19(11-2)12-3)16-21(8,9)14-5;;;/h4-5H,10-12H2,1-3,6-9H3;2*1H3; |
| InChIKey | ZAMUWJFTYHPBIE-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.20 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|