C28H51BSi2Sn — CID 15495143
[3-diethylboranyl-4-ethyl-5-[hex-1-ynyl(dimethyl)silyl]-1,1-dimethylstannol-2-yl]-hex-1-ynyl-dimethylsilane (PubChem CID 15495143) has the molecular formula C28H51BSi2Sn and a molecular weight of 573.41 g/mol. Its IUPAC name is [3-diethylboranyl-4-ethyl-5-[hex-1-ynyl(dimethyl)silyl]-1,1-dimethylstannol-2-yl]-hex-1-ynyl-dimethylsilane.
| Compound Name | [3-diethylboranyl-4-ethyl-5-[hex-1-ynyl(dimethyl)silyl]-1,1-dimethylstannol-2-yl]-hex-1-ynyl-dimethylsilane |
|---|---|
| PubChem CID | 15495143 |
| Molecular Formula | C28H51BSi2Sn |
| Molecular Weight | 573.41 g/mol |
| Exact Mass | 574.26 |
| IUPAC Name | [3-diethylboranyl-4-ethyl-5-[hex-1-ynyl(dimethyl)silyl]-1,1-dimethylstannol-2-yl]-hex-1-ynyl-dimethylsilane |
| SMILES | CCCCC#C[Si](C)(C)C1=C(CC)C(B(CC)CC)=C([Si](C)(C)C#CCCCC)[Sn]1(C)C |
| InChI | InChI=1S/C26H45BSi2.2CH3.Sn/c1-10-15-17-19-21-28(6,7)23-25(12-3)26(27(13-4)14-5)24-29(8,9)22-20-18-16-11-2;;;/h10-18H2,1-9H3;2*1H3; |
| InChIKey | UQBJHAHUWDBUMZ-UHFFFAOYSA-N |
| XLogP | 8.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.41 |
| LogP ≤ 5 | 8.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|