C18H39BSi3 — CID 15151075
(3-diethylboranyl-4-ethyl-1,1-dimethyl-5-trimethylsilylsilol-2-yl)-trimethylsilane (PubChem CID 15151075) has the molecular formula C18H39BSi3 and a molecular weight of 350.58 g/mol. Its IUPAC name is (3-diethylboranyl-4-ethyl-1,1-dimethyl-5-trimethylsilylsilol-2-yl)-trimethylsilane.
| Compound Name | (3-diethylboranyl-4-ethyl-1,1-dimethyl-5-trimethylsilylsilol-2-yl)-trimethylsilane |
|---|---|
| PubChem CID | 15151075 |
| Molecular Formula | C18H39BSi3 |
| Molecular Weight | 350.58 g/mol |
| Exact Mass | 350.25 |
| IUPAC Name | (3-diethylboranyl-4-ethyl-1,1-dimethyl-5-trimethylsilylsilol-2-yl)-trimethylsilane |
| SMILES | CCB(CC)C1=C([Si](C)(C)C)[Si](C)(C)C([Si](C)(C)C)=C1CC |
| InChI | InChI=1S/C18H39BSi3/c1-12-15-16(19(13-2)14-3)18(21(7,8)9)22(10,11)17(15)20(4,5)6/h12-14H2,1-11H3 |
| InChIKey | URVBSEKWJQCGAH-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.58 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|