C19H42Si4 — CID 54060859
ethyl-[[1-ethyl-3,4-dimethyl-2,5-bis(trimethylsilyl)silol-1-yl]methyl]-dimethylsilane (PubChem CID 54060859) has the molecular formula C19H42Si4 and a molecular weight of 382.89 g/mol. Its IUPAC name is ethyl-[[1-ethyl-3,4-dimethyl-2,5-bis(trimethylsilyl)silol-1-yl]methyl]-dimethylsilane.
| Compound Name | ethyl-[[1-ethyl-3,4-dimethyl-2,5-bis(trimethylsilyl)silol-1-yl]methyl]-dimethylsilane |
|---|---|
| PubChem CID | 54060859 |
| Molecular Formula | C19H42Si4 |
| Molecular Weight | 382.89 g/mol |
| Exact Mass | 382.24 |
| IUPAC Name | ethyl-[[1-ethyl-3,4-dimethyl-2,5-bis(trimethylsilyl)silol-1-yl]methyl]-dimethylsilane |
| SMILES | CC[Si](C)(C)C[Si]1(CC)C([Si](C)(C)C)=C(C)C(C)=C1[Si](C)(C)C |
| InChI | InChI=1S/C19H42Si4/c1-13-22(11,12)15-23(14-2)18(20(5,6)7)16(3)17(4)19(23)21(8,9)10/h13-15H2,1-12H3 |
| InChIKey | LZPFIPCFDRAKBR-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.89 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|