C15H34Si3 — CID 12732193
bis(trimethylsilyl)methyl-dimethyl-(3-methyl-2-methylidenebut-3-enyl)silane (PubChem CID 12732193) has the molecular formula C15H34Si3 and a molecular weight of 298.70 g/mol. Its IUPAC name is bis(trimethylsilyl)methyl-dimethyl-(3-methyl-2-methylidenebut-3-enyl)silane.
| Compound Name | bis(trimethylsilyl)methyl-dimethyl-(3-methyl-2-methylidenebut-3-enyl)silane |
|---|---|
| PubChem CID | 12732193 |
| Molecular Formula | C15H34Si3 |
| Molecular Weight | 298.70 g/mol |
| Exact Mass | 298.20 |
| IUPAC Name | bis(trimethylsilyl)methyl-dimethyl-(3-methyl-2-methylidenebut-3-enyl)silane |
| SMILES | C=C(C)C(=C)C[Si](C)(C)C([Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C15H34Si3/c1-13(2)14(3)12-18(10,11)15(16(4,5)6)17(7,8)9/h15H,1,3,12H2,2,4-11H3 |
| InChIKey | CKBLEVZQYNEOTM-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.70 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|