C10H22Si2 — CID 13060902
dimethyl-[(1Z)-3-methylbuta-1,3-dienyl]-trimethylsilylsilane (PubChem CID 13060902) has the molecular formula C10H22Si2 and a molecular weight of 198.46 g/mol. Its IUPAC name is dimethyl-[(1Z)-3-methylbuta-1,3-dienyl]-trimethylsilylsilane.
| Compound Name | dimethyl-[(1Z)-3-methylbuta-1,3-dienyl]-trimethylsilylsilane |
|---|---|
| PubChem CID | 13060902 |
| Molecular Formula | C10H22Si2 |
| Molecular Weight | 198.46 g/mol |
| Exact Mass | 198.13 |
| IUPAC Name | dimethyl-[(1Z)-3-methylbuta-1,3-dienyl]-trimethylsilylsilane |
| SMILES | C=C(C)/C=C\[Si](C)(C)[Si](C)(C)C |
| InChI | InChI=1S/C10H22Si2/c1-10(2)8-9-12(6,7)11(3,4)5/h8-9H,1H2,2-7H3/b9-8- |
| InChIKey | HFWKPDQZZJYXIH-HJWRWDBZSA-N |
| XLogP | 3.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.46 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|