C13H34Si4 — CID 11781638
trimethyl-[2-methylprop-2-enyl-bis(trimethylsilyl)silyl]silane (PubChem CID 11781638) has the molecular formula C13H34Si4 and a molecular weight of 302.76 g/mol. Its IUPAC name is trimethyl-[2-methylprop-2-enyl-bis(trimethylsilyl)silyl]silane.
| Compound Name | trimethyl-[2-methylprop-2-enyl-bis(trimethylsilyl)silyl]silane |
|---|---|
| PubChem CID | 11781638 |
| Molecular Formula | C13H34Si4 |
| Molecular Weight | 302.76 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | trimethyl-[2-methylprop-2-enyl-bis(trimethylsilyl)silyl]silane |
| SMILES | C=C(C)C[Si]([Si](C)(C)C)([Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C13H34Si4/c1-13(2)12-17(14(3,4)5,15(6,7)8)16(9,10)11/h1,12H2,2-11H3 |
| InChIKey | QPGRQOPOFHBWCT-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.76 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|